Molekula L-Aspartic acid
Some chemical or regulated products may require specialist carriage and may not qualify for standard delivery rates. Any additional handling or hazardous goods charge will be confirmed where applicable.
Specification & product details.
L-Aspartic acid is a non-essential amino acid involved in metabolic processes and used in pharmaceuticals, food additives, and research.
CAS number: 56-84-8
Select the required pack size. Contact Bench & Flask for bulk quantities and availability.
Supplier packaging image is illustrative; packaging may vary by pack size.
Specifications
| Property | Value |
| Appearance | White/ off white powder |
| Specific rotation | +24.5 to +26.0 |
| Loss on Drying | ≤ 0.25% |
| Specification | Conforms to USP |
| Chloride (Cl-) | ≤ 0.02% |
| Assay | 98.5 - 101.5% |
| Residue on Ignition | ≤ 0.1% |
| Heavy Metals (Pb) | ≤ 10ppm |
| Organic impurities | ≤ 0.5% |
| Iron (Fe) | ≤ 10ppm |
| Lead (Pb) | ≤ 0.0005% |
| Identification (IR) | Conforms to reference |
| Sulphates (SO4)(2-) | ≤ 0.03% |
Storage & handling
| Property | Value |
| Storage Temperature | 2 to 8 °C |
| Acidity | Acid |
Literature values
Published physical properties of the substance, not batch specifications.
| Property | Value |
| Appearance | White, crystalline solid |
| Melting Point | 270 °C |
| Solubility (other solvents) | Insoluble in ethanol, ethyl ether, benzene; soluble in dilute HCl, pyridine |
| Vapour Pressure | 0.0000013 mmHg |
| pKa | pKa = 2.01 (at 0 °C) |
| log P (octanol/water) | -3.89 |
Identification
| Property | Value |
| SKU | 13231280 |
| CAS Number | 56-84-8 |
| IUPAC Name | (2S)-2-aminobutanedioic acid |
| EC Number | 200-291-6 |
| Molecular Formula | HO2CCH2CH(NH2)CO2H |
| Molecular Weight | 133.10 |
| Exact Mass | 133.0375 |
| SMILES | C(\[C@@H\](C(=O)O)N)C(=O)O |
| InChIKey | CKLJMWTZIZZHCS-REOHCLBHSA-N |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| PubChem CID | 5960 |
| REACH Code | Y113 |
| TSCA Listed | Yes |
| HTS Code | 29224980 |
| Tariff Code | 2922498590 |
Safety & GHS
Precautionary statements
- P280Wear protective gloves/protective clothing/eye protection/face protection
\\
\\
\\
\\
\\
\\
Alternative names
(2S)-2-aminobutanedioic acid; (S)-2-Aminosuccinic acid; (S)-Aspartic acid; Asparagic acid; Asparaginic acid; aspartic acid; Aspartic acid, L-; L-Aminosuccinic acid; L-Asparagic acid; L-Asparaginic acid
Product documentation
Product specification PDF. Batch-specific certificates of analysis and safety data sheets are available on request.
Buying for a laboratory, university or organisation?
Ask about quotations, larger quantities, recurring supply and professional accounts.