Molekula L-Isoleucine
Specification & product details.
L-Isoleucine is an essential branched-chain amino acid critical for protein synthesis, muscle repair, and energy metabolism in humans and animals.
CAS number: 73-32-5
Select the required pack size. Contact Bench & Flask for bulk quantities and availability.
Supplier packaging image is illustrative; packaging may vary by pack size.
Specifications
| Property | Value |
| Appearance | White/ off white powder |
| Specific rotation | +38.9 to +41.8 |
| Heavy metals | ≤15ppm |
| Identification | Conforms to reference |
| pH | 5.5 - 7 |
| Loss on Drying | ≤0.3% |
| Assay | 98.5 - 101.5% |
| Residue on Ignition | ≤0.3% |
| Iron (Fe) | ≤30ppm |
| Arsenic (As) | ≤1.5ppm |
| Sulphates (SO4)(2-) | ≤0.03% |
| Chlorine (Cl) | ≤0.05% |
Storage & handling
| Property | Value |
| Storage Temperature | Ambient |
| Acidity | Neutral |
Literature values
Published physical properties of the substance, not batch specifications.
| Property | Value |
| Appearance | Crystals |
| Melting Point | 284 °C (decomposes) |
| Water Solubility | 34.4 g/L at 25 °C |
| Solubility (other solvents) | Sparingly soluble in hot alcohol (0.13% wt/wt at 80 °C), hot acetic acid. Insoluble in ether |
| Vapour Pressure | 0.00000001 mmHg |
| pKa | pKa = 2.37 (at 0 °C) |
| log P (octanol/water) | -1.72 |
Identification
| Property | Value |
| SKU | 15495360 |
| CAS Number | 73-32-5 |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| EC Number | 200-798-2 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 |
| Exact Mass | 131.0946 |
| SMILES | CC\[C@H\](C)\[C@@H\](C(=O)O)N |
| InChIKey | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| PubChem CID | 6306 |
| REACH Code | Y113 |
| TSCA Listed | Yes |
| HTS Code | 29224980 |
| Tariff Code | 2922498590 |
Safety & GHS
Precautionary statements
- P264Wash thoroughly after handling
- P280Wear protective gloves/protective clothing/eye protection/face protection
\\
\\
\\
\\
\\
\\
Alternative names
(2S,3S)-2-Amino-3-methylpentanoic acid; (S,S)-Isoleucine; (S)-Isoleucine; 2-Amino-3-methylvaleric acid; 2S,3S-Isoleucine; alpha-Amino-beta-methylvaleric acid; erythro-L-Isoleucine; Isoleucina; Isoleucine; L-Ile
Product documentation
Product specification PDF. Batch-specific certificates of analysis and safety data sheets are available on request.
Buying for a laboratory, university or organisation?
Ask about quotations, larger quantities, recurring supply and professional accounts.